C35H25N5O2 — CID 139624287
5-methyl-2-[4-(1-trityltetrazol-5-yl)phenyl]isoindole-1,3-dione (PubChem CID 139624287) has the molecular formula C35H25N5O2 and a molecular weight of 547.62 g/mol. Its IUPAC name is 5-methyl-2-[4-(1-trityltetrazol-5-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-methyl-2-[4-(1-trityltetrazol-5-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139624287 |
| Molecular Formula | C35H25N5O2 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 5-methyl-2-[4-(1-trityltetrazol-5-yl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(c1ccc(-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc1)C2=O |
| InChI | InChI=1S/C35H25N5O2/c1-24-17-22-30-31(23-24)34(42)39(33(30)41)29-20-18-25(19-21-29)32-36-37-38-40(32)35(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-23H,1H3 |
| InChIKey | IURYYSLMNLMJLX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|