C23H20N2O4 — CID 139627834
5-[2-(4-hydroxyphenoxy)ethoxy]-1,2-diphenylpyrazol-3-one (PubChem CID 139627834) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenoxy)ethoxy]-1,2-diphenylpyrazol-3-one.
| Compound Name | 5-[2-(4-hydroxyphenoxy)ethoxy]-1,2-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 139627834 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 5-[2-(4-hydroxyphenoxy)ethoxy]-1,2-diphenylpyrazol-3-one |
| SMILES | O=c1cc(OCCOc2ccc(O)cc2)n(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20N2O4/c26-20-11-13-21(14-12-20)28-15-16-29-23-17-22(27)24(18-7-3-1-4-8-18)25(23)19-9-5-2-6-10-19/h1-14,17,26H,15-16H2 |
| InChIKey | INNUPSFAFPBKCC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|