C25H35NOSi2 — CID 139630788
4-[4-[[[diethyl(prop-1-enyl)silyl]oxy-diethylsilyl]methyl]phenyl]benzonitrile (PubChem CID 139630788) has the molecular formula C25H35NOSi2 and a molecular weight of 421.73 g/mol. Its IUPAC name is 4-[4-[[[diethyl(prop-1-enyl)silyl]oxy-diethylsilyl]methyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[[[diethyl(prop-1-enyl)silyl]oxy-diethylsilyl]methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139630788 |
| Molecular Formula | C25H35NOSi2 |
| Molecular Weight | 421.73 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 4-[4-[[[diethyl(prop-1-enyl)silyl]oxy-diethylsilyl]methyl]phenyl]benzonitrile |
| SMILES | CC=C[Si](CC)(CC)O[Si](CC)(CC)Cc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C25H35NOSi2/c1-6-19-28(7-2,8-3)27-29(9-4,10-5)21-23-13-17-25(18-14-23)24-15-11-22(20-26)12-16-24/h6,11-19H,7-10,21H2,1-5H3 |
| InChIKey | GEBXLOKDACCGSE-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.73 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|