C21H38O3 — CID 139632039
2-[(2Z,6Z)-12-methoxy-2,6,10-trimethyldodeca-2,6-dienoxy]oxane (PubChem CID 139632039) has the molecular formula C21H38O3 and a molecular weight of 338.53 g/mol. Its IUPAC name is 2-[(2Z,6Z)-12-methoxy-2,6,10-trimethyldodeca-2,6-dienoxy]oxane.
| Compound Name | 2-[(2Z,6Z)-12-methoxy-2,6,10-trimethyldodeca-2,6-dienoxy]oxane |
|---|---|
| PubChem CID | 139632039 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | 2-[(2Z,6Z)-12-methoxy-2,6,10-trimethyldodeca-2,6-dienoxy]oxane |
| SMILES | COCCC(C)CC/C=C(/C)CC/C=C(/C)COC1CCCCO1 |
| InChI | InChI=1S/C21H38O3/c1-18(9-7-11-19(2)14-16-22-4)10-8-12-20(3)17-24-21-13-5-6-15-23-21/h9,12,19,21H,5-8,10-11,13-17H2,1-4H3/b18-9-,20-12- |
| InChIKey | BJFQCLQFZZOVDQ-FZQSDHEOSA-N |
| XLogP | 5.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|