C28H23NO2 — CID 139634924
1,1-diphenylprop-2-enyl N,N-diphenylcarbamate (PubChem CID 139634924) has the molecular formula C28H23NO2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1,1-diphenylprop-2-enyl N,N-diphenylcarbamate.
| Compound Name | 1,1-diphenylprop-2-enyl N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 139634924 |
| Molecular Formula | C28H23NO2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1,1-diphenylprop-2-enyl N,N-diphenylcarbamate |
| SMILES | C=CC(OC(=O)N(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23NO2/c1-2-28(23-15-7-3-8-16-23,24-17-9-4-10-18-24)31-27(30)29(25-19-11-5-12-20-25)26-21-13-6-14-22-26/h2-22H,1H2 |
| InChIKey | CYGMQFKJIOTOJY-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|