C28H41F3N2O11 — CID 139635382
butyl (2R,3S,5R)-2-(butoxycarbonyloxymethyl)-5-[3-(heptanoyloxymethyl)-2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-hydroxyoxolane-3-carboxylate (PubChem CID 139635382) has the molecular formula C28H41F3N2O11 and a molecular weight of 638.63 g/mol. Its IUPAC name is butyl (2R,3S,5R)-2-(butoxycarbonyloxymethyl)-5-[3-(heptanoyloxymethyl)-2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-hydroxyoxolane-3-carboxylate.
| Compound Name | butyl (2R,3S,5R)-2-(butoxycarbonyloxymethyl)-5-[3-(heptanoyloxymethyl)-2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-hydroxyoxolane-3-carboxylate |
|---|---|
| PubChem CID | 139635382 |
| Molecular Formula | C28H41F3N2O11 |
| Molecular Weight | 638.63 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | butyl (2R,3S,5R)-2-(butoxycarbonyloxymethyl)-5-[3-(heptanoyloxymethyl)-2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-hydroxyoxolane-3-carboxylate |
| SMILES | CCCCCCC(=O)OCn1c(=O)c(C(F)(F)F)cn([C@H]2C[C@@](O)(C(=O)OCCCC)[C@@H](COC(=O)OCCCC)O2)c1=O |
| InChI | InChI=1S/C28H41F3N2O11/c1-4-7-10-11-12-22(34)43-18-33-23(35)19(28(29,30)31)16-32(25(33)37)21-15-27(39,24(36)40-13-8-5-2)20(44-21)17-42-26(38)41-14-9-6-3/h16,20-21,39H,4-15,17-18H2,1-3H3/t20-,21-,27+/m1/s1 |
| InChIKey | XEDASHGBBLWMPI-GNMOFYLKSA-N |
| XLogP | 3.82 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|