C26H37F3N2O9 — CID 54573718
[3-[(2R,4S,5R)-4-butanoyloxy-5-(butanoyloxymethyl)oxolan-2-yl]-2,6-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methyl heptanoate (PubChem CID 54573718) has the molecular formula C26H37F3N2O9 and a molecular weight of 578.58 g/mol. Its IUPAC name is [3-[(2R,4S,5R)-4-butanoyloxy-5-(butanoyloxymethyl)oxolan-2-yl]-2,6-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methyl heptanoate.
| Compound Name | [3-[(2R,4S,5R)-4-butanoyloxy-5-(butanoyloxymethyl)oxolan-2-yl]-2,6-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methyl heptanoate |
|---|---|
| PubChem CID | 54573718 |
| Molecular Formula | C26H37F3N2O9 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | [3-[(2R,4S,5R)-4-butanoyloxy-5-(butanoyloxymethyl)oxolan-2-yl]-2,6-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methyl heptanoate |
| SMILES | CCCCCCC(=O)OCn1c(=O)c(C(F)(F)F)cn([C@H]2C[C@H](OC(=O)CCC)[C@@H](COC(=O)CCC)O2)c1=O |
| InChI | InChI=1S/C26H37F3N2O9/c1-4-7-8-9-12-22(33)38-16-31-24(35)17(26(27,28)29)14-30(25(31)36)20-13-18(40-23(34)11-6-3)19(39-20)15-37-21(32)10-5-2/h14,18-20H,4-13,15-16H2,1-3H3/t18-,19+,20+/m0/s1 |
| InChIKey | ZZCKCEKZUQTWSD-XUVXKRRUSA-N |
| XLogP | 3.84 |
| TPSA | 132.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|