C18H14 — CID 139636229
1-buta-1,3-diynyl-4-(3-ethylphenyl)benzene (PubChem CID 139636229) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-buta-1,3-diynyl-4-(3-ethylphenyl)benzene.
| Compound Name | 1-buta-1,3-diynyl-4-(3-ethylphenyl)benzene |
|---|---|
| PubChem CID | 139636229 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-buta-1,3-diynyl-4-(3-ethylphenyl)benzene |
| SMILES | C#CC#Cc1ccc(-c2cccc(CC)c2)cc1 |
| InChI | InChI=1S/C18H14/c1-3-5-7-16-10-12-17(13-11-16)18-9-6-8-15(4-2)14-18/h1,6,8-14H,4H2,2H3 |
| InChIKey | CVRGAUYXNDNIPD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|