C25H34O4S — CID 139637456
(2R,3S,3aS,6aS)-5-(benzenesulfonylmethyl)-3-[(E,3S)-3-cyclohexyl-3-hydroxybut-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 139637456) has the molecular formula C25H34O4S and a molecular weight of 430.61 g/mol. Its IUPAC name is (2R,3S,3aS,6aS)-5-(benzenesulfonylmethyl)-3-[(E,3S)-3-cyclohexyl-3-hydroxybut-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3S,3aS,6aS)-5-(benzenesulfonylmethyl)-3-[(E,3S)-3-cyclohexyl-3-hydroxybut-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 139637456 |
| Molecular Formula | C25H34O4S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2R,3S,3aS,6aS)-5-(benzenesulfonylmethyl)-3-[(E,3S)-3-cyclohexyl-3-hydroxybut-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | C[C@@](O)(/C=C/[C@H]1[C@H]2CC(CS(=O)(=O)c3ccccc3)=C[C@H]2C[C@H]1O)C1CCCCC1 |
| InChI | InChI=1S/C25H34O4S/c1-25(27,20-8-4-2-5-9-20)13-12-22-23-15-18(14-19(23)16-24(22)26)17-30(28,29)21-10-6-3-7-11-21/h3,6-7,10-14,19-20,22-24,26-27H,2,4-5,8-9,15-17H2,1H3/b13-12+/t19-,22-,23-,24+,25+/m0/s1 |
| InChIKey | ITSGBCLKRJAKNT-ZNFWQGNKSA-N |
| XLogP | 4.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|