C29H42O6S — CID 139637458
methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,4R)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate (PubChem CID 139637458) has the molecular formula C29H42O6S and a molecular weight of 518.72 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,4R)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate.
| Compound Name | methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,4R)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate |
|---|---|
| PubChem CID | 139637458 |
| Molecular Formula | C29H42O6S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,4R)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate |
| SMILES | CCCC[C@@](C)(O)C/C=C/[C@H]1[C@H]2CC(C(CCCC(=O)OC)S(=O)(=O)c3ccccc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C29H42O6S/c1-4-5-16-29(2,32)17-10-13-24-25-19-22(18-21(25)20-26(24)30)27(14-9-15-28(31)35-3)36(33,34)23-11-7-6-8-12-23/h6-8,10-13,18,21,24-27,30,32H,4-5,9,14-17,19-20H2,1-3H3/b13-10+/t21-,24-,25-,26+,27?,29+/m0/s1 |
| InChIKey | DOIHBHUBPQYQNN-RSETYJNASA-N |
| XLogP | 5.00 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|