C30H42O6S — CID 139637459
methyl 5-[(3aS,5R,6S,6aS)-6-[(E,3S)-3-cyclohexyl-3-hydroxybut-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate (PubChem CID 139637459) has the molecular formula C30H42O6S and a molecular weight of 530.73 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6S,6aS)-6-[(E,3S)-3-cyclohexyl-3-hydroxybut-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate.
| Compound Name | methyl 5-[(3aS,5R,6S,6aS)-6-[(E,3S)-3-cyclohexyl-3-hydroxybut-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate |
|---|---|
| PubChem CID | 139637459 |
| Molecular Formula | C30H42O6S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | methyl 5-[(3aS,5R,6S,6aS)-6-[(E,3S)-3-cyclohexyl-3-hydroxybut-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate |
| SMILES | COC(=O)CCCC(C1=C[C@H]2C[C@@H](O)[C@@H](/C=C/[C@@](C)(O)C3CCCCC3)[C@H]2C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H42O6S/c1-30(33,23-10-5-3-6-11-23)17-16-25-26-19-22(18-21(26)20-27(25)31)28(14-9-15-29(32)36-2)37(34,35)24-12-7-4-8-13-24/h4,7-8,12-13,16-18,21,23,25-28,31,33H,3,5-6,9-11,14-15,19-20H2,1-2H3/b17-16+/t21-,25-,26-,27+,28?,30+/m0/s1 |
| InChIKey | UQKFZCZIDYYGRE-VPZZBSGYSA-N |
| XLogP | 5.00 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|