C14H13NO3 — CID 139637939
2-(3-hydroxyphenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 139637939) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(3-hydroxyphenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 139637939 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(3-hydroxyphenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2C=CCCC2C(=O)N1c1cccc(O)c1 |
| InChI | InChI=1S/C14H13NO3/c16-10-5-3-4-9(8-10)15-13(17)11-6-1-2-7-12(11)14(15)18/h1,3-6,8,11-12,16H,2,7H2 |
| InChIKey | FETATHVVBRSCDZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|