About methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate
methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate (PubChem CID 139638337) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate.
Analyze methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate?
The IUPAC name of methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate (CID 139638337) is methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate.
What is the SMILES notation for methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate?
The canonical SMILES for methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate is COC(=O)C1=C2CCC(=C1)C2.
What is the InChIKey of methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate?
The InChIKey is PMERMQUXJMHEEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-11-9(10)8-5-6-2-3-7(8)4-6/h5H,2-4H2,1H3.
What are the key properties of methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate?
methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate has a molecular weight of 150.18 g/mol, XLogP of 1.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl bicyclo[2.2.1]hepta-1,3-diene-2-carboxylate is sourced from PubChem (CID 139638337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).