C24H37NO3Si — CID 139640695
methyl (2R,3S)-3-[[(1S)-1-methylcyclohexa-2,4-dien-1-yl]methylamino]-3-phenyl-2-triethylsilyloxypropanoate (PubChem CID 139640695) has the molecular formula C24H37NO3Si and a molecular weight of 415.65 g/mol. Its IUPAC name is methyl (2R,3S)-3-[[(1S)-1-methylcyclohexa-2,4-dien-1-yl]methylamino]-3-phenyl-2-triethylsilyloxypropanoate.
| Compound Name | methyl (2R,3S)-3-[[(1S)-1-methylcyclohexa-2,4-dien-1-yl]methylamino]-3-phenyl-2-triethylsilyloxypropanoate |
|---|---|
| PubChem CID | 139640695 |
| Molecular Formula | C24H37NO3Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | methyl (2R,3S)-3-[[(1S)-1-methylcyclohexa-2,4-dien-1-yl]methylamino]-3-phenyl-2-triethylsilyloxypropanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](C(=O)OC)[C@@H](NC[C@]1(C)C=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C24H37NO3Si/c1-6-29(7-2,8-3)28-22(23(26)27-5)21(20-15-11-9-12-16-20)25-19-24(4)17-13-10-14-18-24/h9-17,21-22,25H,6-8,18-19H2,1-5H3/t21-,22+,24+/m0/s1 |
| InChIKey | ZRERIVRXFQRNQL-WMTXJRDZSA-N |
| XLogP | 5.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|