C28H33NO4 — CID 88639986
(E)-but-2-enedioic acid;N-[2-(1-methylcyclohexa-2,4-dien-1-yl)ethyl]-3,3-diphenylpropan-1-amine (PubChem CID 88639986) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[2-(1-methylcyclohexa-2,4-dien-1-yl)ethyl]-3,3-diphenylpropan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[2-(1-methylcyclohexa-2,4-dien-1-yl)ethyl]-3,3-diphenylpropan-1-amine |
|---|---|
| PubChem CID | 88639986 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[2-(1-methylcyclohexa-2,4-dien-1-yl)ethyl]-3,3-diphenylpropan-1-amine |
| SMILES | CC1(CCNCCC(c2ccccc2)c2ccccc2)C=CC=CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H29N.C4H4O4/c1-24(16-9-4-10-17-24)18-20-25-19-15-23(21-11-5-2-6-12-21)22-13-7-3-8-14-22;5-3(6)1-2-4(7)8/h2-14,16,23,25H,15,17-20H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HXFBZEQIAOFJCN-WLHGVMLRSA-N |
| XLogP | 5.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|