C32H31N3O5S — CID 139641062
benzhydryl 8-oxo-7-[[(E)-1-[(2-phenylacetyl)amino]propan-2-ylideneamino]oxymethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139641062) has the molecular formula C32H31N3O5S and a molecular weight of 569.68 g/mol. Its IUPAC name is benzhydryl 8-oxo-7-[[(E)-1-[(2-phenylacetyl)amino]propan-2-ylideneamino]oxymethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl 8-oxo-7-[[(E)-1-[(2-phenylacetyl)amino]propan-2-ylideneamino]oxymethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139641062 |
| Molecular Formula | C32H31N3O5S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | benzhydryl 8-oxo-7-[[(E)-1-[(2-phenylacetyl)amino]propan-2-ylideneamino]oxymethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C/C(CNC(=O)Cc1ccccc1)=N\OCC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=CCSC12 |
| InChI | InChI=1S/C32H31N3O5S/c1-22(20-33-28(36)19-23-11-5-2-6-12-23)34-39-21-26-30(37)35-27(17-18-41-31(26)35)32(38)40-29(24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-17,26,29,31H,18-21H2,1H3,(H,33,36)/b34-22+ |
| InChIKey | WFCYSGQBXJHCST-PPOKSSTKSA-N |
| XLogP | 4.49 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|