C30H26INO4S — CID 158350547
benzhydryl (6R,7R)-3-(iodomethyl)-8-oxo-7-(2-oxo-3-phenylpropyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 158350547) has the molecular formula C30H26INO4S and a molecular weight of 623.51 g/mol. Its IUPAC name is benzhydryl (6R,7R)-3-(iodomethyl)-8-oxo-7-(2-oxo-3-phenylpropyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-3-(iodomethyl)-8-oxo-7-(2-oxo-3-phenylpropyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 158350547 |
| Molecular Formula | C30H26INO4S |
| Molecular Weight | 623.51 g/mol |
| Exact Mass | 623.06 |
| IUPAC Name | benzhydryl (6R,7R)-3-(iodomethyl)-8-oxo-7-(2-oxo-3-phenylpropyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(Cc1ccccc1)C[C@@H]1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(CI)CS[C@H]12 |
| InChI | InChI=1S/C30H26INO4S/c31-18-23-19-37-29-25(17-24(33)16-20-10-4-1-5-11-20)28(34)32(29)26(23)30(35)36-27(21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,25,27,29H,16-19H2/t25-,29-/m1/s1 |
| InChIKey | GSGKCXZXOBWEAH-VAVYLYDRSA-N |
| XLogP | 5.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|