C13H13F3 — CID 139646202
4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene (PubChem CID 139646202) has the molecular formula C13H13F3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene.
| Compound Name | 4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene |
|---|---|
| PubChem CID | 139646202 |
| Molecular Formula | C13H13F3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene |
| SMILES | FC(F)(F)C1=CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C13H13F3/c14-13(15,16)10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h1-2,5-9,11-12H,3-4H2 |
| InChIKey | AEMVNDJDDRGVKF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|