C13H10F6 — CID 22026370
9,9,10-trifluoro-10-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene (PubChem CID 22026370) has the molecular formula C13H10F6 and a molecular weight of 280.21 g/mol. Its IUPAC name is 9,9,10-trifluoro-10-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene.
| Compound Name | 9,9,10-trifluoro-10-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
|---|---|
| PubChem CID | 22026370 |
| Molecular Formula | C13H10F6 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 9,9,10-trifluoro-10-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
| SMILES | FC(F)(F)C1(F)C2CC(C3=C2C2C=CC3C2)C1(F)F |
| InChI | InChI=1S/C13H10F6/c14-11(13(17,18)19)7-4-8(12(11,15)16)10-6-2-1-5(3-6)9(7)10/h1-2,5-8H,3-4H2 |
| InChIKey | OABUKPXJWNFFPZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|