C17H23Br6O5P — CID 139650293
(4-methylphenoxy) bis(1,1,3-tribromo-2,2-dimethylpropyl) phosphate (PubChem CID 139650293) has the molecular formula C17H23Br6O5P and a molecular weight of 817.76 g/mol. Its IUPAC name is (4-methylphenoxy) bis(1,1,3-tribromo-2,2-dimethylpropyl) phosphate.
| Compound Name | (4-methylphenoxy) bis(1,1,3-tribromo-2,2-dimethylpropyl) phosphate |
|---|---|
| PubChem CID | 139650293 |
| Molecular Formula | C17H23Br6O5P |
| Molecular Weight | 817.76 g/mol |
| Exact Mass | 811.64 |
| IUPAC Name | (4-methylphenoxy) bis(1,1,3-tribromo-2,2-dimethylpropyl) phosphate |
| SMILES | Cc1ccc(OOP(=O)(OC(Br)(Br)C(C)(C)CBr)OC(Br)(Br)C(C)(C)CBr)cc1 |
| InChI | InChI=1S/C17H23Br6O5P/c1-12-6-8-13(9-7-12)25-28-29(24,26-16(20,21)14(2,3)10-18)27-17(22,23)15(4,5)11-19/h6-9H,10-11H2,1-5H3 |
| InChIKey | QSJJQECXNRUNRX-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.76 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|