C11H12Br3Cl10O4P — CID 88822213
(3-bromo-1,1-dichloro-2,2-dimethylpropyl) bis(3-bromo-1,1,2,2-tetrachloropropyl) phosphate (PubChem CID 88822213) has the molecular formula C11H12Br3Cl10O4P and a molecular weight of 833.43 g/mol. Its IUPAC name is (3-bromo-1,1-dichloro-2,2-dimethylpropyl) bis(3-bromo-1,1,2,2-tetrachloropropyl) phosphate.
| Compound Name | (3-bromo-1,1-dichloro-2,2-dimethylpropyl) bis(3-bromo-1,1,2,2-tetrachloropropyl) phosphate |
|---|---|
| PubChem CID | 88822213 |
| Molecular Formula | C11H12Br3Cl10O4P |
| Molecular Weight | 833.43 g/mol |
| Exact Mass | 825.49 |
| IUPAC Name | (3-bromo-1,1-dichloro-2,2-dimethylpropyl) bis(3-bromo-1,1,2,2-tetrachloropropyl) phosphate |
| SMILES | CC(C)(CBr)C(Cl)(Cl)OP(=O)(OC(Cl)(Cl)C(Cl)(Cl)CBr)OC(Cl)(Cl)C(Cl)(Cl)CBr |
| InChI | InChI=1S/C11H12Br3Cl10O4P/c1-6(2,3-12)9(19,20)26-29(25,27-10(21,22)7(15,16)4-13)28-11(23,24)8(17,18)5-14/h3-5H2,1-2H3 |
| InChIKey | VYVCYDMEEGHTFL-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.43 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|