C12H18Br9O4P — CID 139744009
tris(1,1,1-tribromo-2-methylpropan-2-yl) phosphate (PubChem CID 139744009) has the molecular formula C12H18Br9O4P and a molecular weight of 976.38 g/mol. Its IUPAC name is tris(1,1,1-tribromo-2-methylpropan-2-yl) phosphate.
| Compound Name | tris(1,1,1-tribromo-2-methylpropan-2-yl) phosphate |
|---|---|
| PubChem CID | 139744009 |
| Molecular Formula | C12H18Br9O4P |
| Molecular Weight | 976.38 g/mol |
| Exact Mass | 967.36 |
| IUPAC Name | tris(1,1,1-tribromo-2-methylpropan-2-yl) phosphate |
| SMILES | CC(C)(OP(=O)(OC(C)(C)C(Br)(Br)Br)OC(C)(C)C(Br)(Br)Br)C(Br)(Br)Br |
| InChI | InChI=1S/C12H18Br9O4P/c1-7(2,10(13,14)15)23-26(22,24-8(3,4)11(16,17)18)25-9(5,6)12(19,20)21/h1-6H3 |
| InChIKey | CAZRQRKOAQORKG-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.38 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|