C12H22Br6NO3P — CID 54101610
N-bis(1,1,3-tribromo-2,2-dimethylpropoxy)phosphoryl-N-methylmethanamine (PubChem CID 54101610) has the molecular formula C12H22Br6NO3P and a molecular weight of 738.71 g/mol. Its IUPAC name is N-bis(1,1,3-tribromo-2,2-dimethylpropoxy)phosphoryl-N-methylmethanamine.
| Compound Name | N-bis(1,1,3-tribromo-2,2-dimethylpropoxy)phosphoryl-N-methylmethanamine |
|---|---|
| PubChem CID | 54101610 |
| Molecular Formula | C12H22Br6NO3P |
| Molecular Weight | 738.71 g/mol |
| Exact Mass | 732.64 |
| IUPAC Name | N-bis(1,1,3-tribromo-2,2-dimethylpropoxy)phosphoryl-N-methylmethanamine |
| SMILES | CN(C)P(=O)(OC(Br)(Br)C(C)(C)CBr)OC(Br)(Br)C(C)(C)CBr |
| InChI | InChI=1S/C12H22Br6NO3P/c1-9(2,7-13)11(15,16)21-23(20,19(5)6)22-12(17,18)10(3,4)8-14/h7-8H2,1-6H3 |
| InChIKey | NAWIFPNMHDMPGI-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.71 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|