C6H10Br3NO — CID 88837831
2,2,4-tribromo-3,3-dimethylbutanamide (PubChem CID 88837831) has the molecular formula C6H10Br3NO and a molecular weight of 351.86 g/mol. Its IUPAC name is 2,2,4-tribromo-3,3-dimethylbutanamide.
| Compound Name | 2,2,4-tribromo-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 88837831 |
| Molecular Formula | C6H10Br3NO |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 348.83 |
| IUPAC Name | 2,2,4-tribromo-3,3-dimethylbutanamide |
| SMILES | CC(C)(CBr)C(Br)(Br)C(N)=O |
| InChI | InChI=1S/C6H10Br3NO/c1-5(2,3-7)6(8,9)4(10)11/h3H2,1-2H3,(H2,10,11) |
| InChIKey | KOVPILUIGOWKDI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|