C14H15Br3Cl5O4P — CID 21412984
(3-bromo-1,1-dichloro-2,2-dimethylpropyl) (2,3-dibromo-1,1,2-trichloropropyl) phenyl phosphate (PubChem CID 21412984) has the molecular formula C14H15Br3Cl5O4P and a molecular weight of 695.22 g/mol. Its IUPAC name is (3-bromo-1,1-dichloro-2,2-dimethylpropyl) (2,3-dibromo-1,1,2-trichloropropyl) phenyl phosphate.
| Compound Name | (3-bromo-1,1-dichloro-2,2-dimethylpropyl) (2,3-dibromo-1,1,2-trichloropropyl) phenyl phosphate |
|---|---|
| PubChem CID | 21412984 |
| Molecular Formula | C14H15Br3Cl5O4P |
| Molecular Weight | 695.22 g/mol |
| Exact Mass | 689.67 |
| IUPAC Name | (3-bromo-1,1-dichloro-2,2-dimethylpropyl) (2,3-dibromo-1,1,2-trichloropropyl) phenyl phosphate |
| SMILES | CC(C)(CBr)C(Cl)(Cl)OP(=O)(Oc1ccccc1)OC(Cl)(Cl)C(Cl)(Br)CBr |
| InChI | InChI=1S/C14H15Br3Cl5O4P/c1-11(2,8-15)13(19,20)25-27(23,24-10-6-4-3-5-7-10)26-14(21,22)12(17,18)9-16/h3-7H,8-9H2,1-2H3 |
| InChIKey | SFWRXHKTEQKCKN-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.22 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|