About tert-butyl diethylamino phenyl phosphate
tert-butyl diethylamino phenyl phosphate (PubChem CID 151235255) has the molecular formula C14H24NO4P
and a molecular weight of 301.32 g/mol. Its IUPAC name is tert-butyl diethylamino phenyl phosphate.
Molecular Properties
| Compound Name | tert-butyl diethylamino phenyl phosphate |
| PubChem CID | 151235255 |
| Molecular Formula | C14H24NO4P |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | tert-butyl diethylamino phenyl phosphate |
| SMILES | CCN(CC)OP(=O)(Oc1ccccc1)OC(C)(C)C |
| InChI | InChI=1S/C14H24NO4P/c1-6-15(7-2)19-20(16,18-14(3,4)5)17-13-11-9-8-10-12-13/h8-12H,6-7H2,1-5H3 |
| InChIKey | NPDGWRJELKWXQZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl diethylamino phenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl diethylamino phenyl phosphate?
The IUPAC name of tert-butyl diethylamino phenyl phosphate (CID 151235255) is tert-butyl diethylamino phenyl phosphate.
What is the SMILES notation for tert-butyl diethylamino phenyl phosphate?
The canonical SMILES for tert-butyl diethylamino phenyl phosphate is CCN(CC)OP(=O)(Oc1ccccc1)OC(C)(C)C.
What is the InChIKey of tert-butyl diethylamino phenyl phosphate?
The InChIKey is NPDGWRJELKWXQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24NO4P/c1-6-15(7-2)19-20(16,18-14(3,4)5)17-13-11-9-8-10-12-13/h8-12H,6-7H2,1-5H3.
What are the key properties of tert-butyl diethylamino phenyl phosphate?
tert-butyl diethylamino phenyl phosphate has a molecular weight of 301.32 g/mol, XLogP of 4.26, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl diethylamino phenyl phosphate is sourced from PubChem (CID 151235255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).