C32H41Br19O12P2 — CID 87257005
3,4,5,6-tetrabromophthalic acid;tris(2,3-dibromopropyl) phosphate;tris(1,1,3-tribromo-2,2-dimethylpropyl) phosphate (PubChem CID 87257005) has the molecular formula C32H41Br19O12P2 and a molecular weight of 2197.79 g/mol. Its IUPAC name is 3,4,5,6-tetrabromophthalic acid;tris(2,3-dibromopropyl) phosphate;tris(1,1,3-tribromo-2,2-dimethylpropyl) phosphate.
| Compound Name | 3,4,5,6-tetrabromophthalic acid;tris(2,3-dibromopropyl) phosphate;tris(1,1,3-tribromo-2,2-dimethylpropyl) phosphate |
|---|---|
| PubChem CID | 87257005 |
| Molecular Formula | C32H41Br19O12P2 |
| Molecular Weight | 2197.79 g/mol |
| Exact Mass | 2178.66 |
| IUPAC Name | 3,4,5,6-tetrabromophthalic acid;tris(2,3-dibromopropyl) phosphate;tris(1,1,3-tribromo-2,2-dimethylpropyl) phosphate |
| SMILES | CC(C)(CBr)C(Br)(Br)OP(=O)(OC(Br)(Br)C(C)(C)CBr)OC(Br)(Br)C(C)(C)CBr.O=C(O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)O.O=P(OCC(Br)CBr)(OCC(Br)CBr)OCC(Br)CBr |
| InChI | InChI=1S/C15H24Br9O4P.C9H15Br6O4P.C8H2Br4O4/c1-10(2,7-16)13(19,20)26-29(25,27-14(21,22)11(3,4)8-17)28-15(23,24)12(5,6)9-18;10-1-7(13)4-17-20(16,18-5-8(14)2-11)19-6-9(15)3-12;9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11/h7-9H2,1-6H3;7-9H,1-6H2;(H,13,14)(H,15,16) |
| InChIKey | KHOALEXCQITAGL-UHFFFAOYSA-N |
| XLogP | 20.49 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2197.79 |
| LogP ≤ 5 | 20.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|