C13H26Cl3O4P — CID 87778288
bis(2-methylpropyl) (1,1,3-trichloro-2,2-dimethylpropyl) phosphate (PubChem CID 87778288) has the molecular formula C13H26Cl3O4P and a molecular weight of 383.68 g/mol. Its IUPAC name is bis(2-methylpropyl) (1,1,3-trichloro-2,2-dimethylpropyl) phosphate.
| Compound Name | bis(2-methylpropyl) (1,1,3-trichloro-2,2-dimethylpropyl) phosphate |
|---|---|
| PubChem CID | 87778288 |
| Molecular Formula | C13H26Cl3O4P |
| Molecular Weight | 383.68 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | bis(2-methylpropyl) (1,1,3-trichloro-2,2-dimethylpropyl) phosphate |
| SMILES | CC(C)COP(=O)(OCC(C)C)OC(Cl)(Cl)C(C)(C)CCl |
| InChI | InChI=1S/C13H26Cl3O4P/c1-10(2)7-18-21(17,19-8-11(3)4)20-13(15,16)12(5,6)9-14/h10-11H,7-9H2,1-6H3 |
| InChIKey | VVFRATINXNBZKT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|