C12H22Cl3O5P — CID 23280284
[1-[bis(2-methylpropoxy)phosphoryl]-2,2,2-trichloroethyl] acetate (PubChem CID 23280284) has the molecular formula C12H22Cl3O5P and a molecular weight of 383.64 g/mol. Its IUPAC name is [1-[bis(2-methylpropoxy)phosphoryl]-2,2,2-trichloroethyl] acetate.
| Compound Name | [1-[bis(2-methylpropoxy)phosphoryl]-2,2,2-trichloroethyl] acetate |
|---|---|
| PubChem CID | 23280284 |
| Molecular Formula | C12H22Cl3O5P |
| Molecular Weight | 383.64 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | [1-[bis(2-methylpropoxy)phosphoryl]-2,2,2-trichloroethyl] acetate |
| SMILES | CC(=O)OC(C(Cl)(Cl)Cl)P(=O)(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C12H22Cl3O5P/c1-8(2)6-18-21(17,19-7-9(3)4)11(12(13,14)15)20-10(5)16/h8-9,11H,6-7H2,1-5H3 |
| InChIKey | MYTKOPHHAIHCAO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|