C12H23Cl2O5P — CID 23418146
[1-[bis(2-methylpropoxy)phosphoryl]-2,2-dichloroethyl] acetate (PubChem CID 23418146) has the molecular formula C12H23Cl2O5P and a molecular weight of 349.19 g/mol. Its IUPAC name is [1-[bis(2-methylpropoxy)phosphoryl]-2,2-dichloroethyl] acetate.
| Compound Name | [1-[bis(2-methylpropoxy)phosphoryl]-2,2-dichloroethyl] acetate |
|---|---|
| PubChem CID | 23418146 |
| Molecular Formula | C12H23Cl2O5P |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | [1-[bis(2-methylpropoxy)phosphoryl]-2,2-dichloroethyl] acetate |
| SMILES | CC(=O)OC(C(Cl)Cl)P(=O)(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C12H23Cl2O5P/c1-8(2)6-17-20(16,18-7-9(3)4)12(11(13)14)19-10(5)15/h8-9,11-12H,6-7H2,1-5H3 |
| InChIKey | WCTNIVFQPFIHAD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|