C11H20BrCl4O4P — CID 141287691
(3-bromo-2,2-dimethylpropyl) bis(1,2-dichloropropan-2-yl) phosphate (PubChem CID 141287691) has the molecular formula C11H20BrCl4O4P and a molecular weight of 468.97 g/mol. Its IUPAC name is (3-bromo-2,2-dimethylpropyl) bis(1,2-dichloropropan-2-yl) phosphate.
| Compound Name | (3-bromo-2,2-dimethylpropyl) bis(1,2-dichloropropan-2-yl) phosphate |
|---|---|
| PubChem CID | 141287691 |
| Molecular Formula | C11H20BrCl4O4P |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 465.90 |
| IUPAC Name | (3-bromo-2,2-dimethylpropyl) bis(1,2-dichloropropan-2-yl) phosphate |
| SMILES | CC(C)(CBr)COP(=O)(OC(C)(Cl)CCl)OC(C)(Cl)CCl |
| InChI | InChI=1S/C11H20BrCl4O4P/c1-9(2,5-12)8-18-21(17,19-10(3,15)6-13)20-11(4,16)7-14/h5-8H2,1-4H3 |
| InChIKey | IDVVWPLZAKJMCZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|