C11H20Cl5O4P — CID 88805126
[3-chloro-2,2-bis(chloromethyl)propyl] bis(1-chloropropyl) phosphate (PubChem CID 88805126) has the molecular formula C11H20Cl5O4P and a molecular weight of 424.52 g/mol. Its IUPAC name is [3-chloro-2,2-bis(chloromethyl)propyl] bis(1-chloropropyl) phosphate.
| Compound Name | [3-chloro-2,2-bis(chloromethyl)propyl] bis(1-chloropropyl) phosphate |
|---|---|
| PubChem CID | 88805126 |
| Molecular Formula | C11H20Cl5O4P |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | [3-chloro-2,2-bis(chloromethyl)propyl] bis(1-chloropropyl) phosphate |
| SMILES | CCC(Cl)OP(=O)(OCC(CCl)(CCl)CCl)OC(Cl)CC |
| InChI | InChI=1S/C11H20Cl5O4P/c1-3-9(15)19-21(17,20-10(16)4-2)18-8-11(5-12,6-13)7-14/h9-10H,3-8H2,1-2H3 |
| InChIKey | OGZYYCLYYXSQRH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|