About ditert-butyl 1-chloropropyl phosphate
ditert-butyl 1-chloropropyl phosphate (PubChem CID 140959745) has the molecular formula C11H24ClO4P
and a molecular weight of 286.74 g/mol. Its IUPAC name is ditert-butyl 1-chloropropyl phosphate.
Molecular Properties
| Compound Name | ditert-butyl 1-chloropropyl phosphate |
| PubChem CID | 140959745 |
| Molecular Formula | C11H24ClO4P |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | ditert-butyl 1-chloropropyl phosphate |
| SMILES | CCC(Cl)OP(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C11H24ClO4P/c1-8-9(12)14-17(13,15-10(2,3)4)16-11(5,6)7/h9H,8H2,1-7H3 |
| InChIKey | FRMXATYWOJEJBX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 1-chloropropyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 1-chloropropyl phosphate?
The IUPAC name of ditert-butyl 1-chloropropyl phosphate (CID 140959745) is ditert-butyl 1-chloropropyl phosphate.
What is the SMILES notation for ditert-butyl 1-chloropropyl phosphate?
The canonical SMILES for ditert-butyl 1-chloropropyl phosphate is CCC(Cl)OP(=O)(OC(C)(C)C)OC(C)(C)C.
What is the InChIKey of ditert-butyl 1-chloropropyl phosphate?
The InChIKey is FRMXATYWOJEJBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24ClO4P/c1-8-9(12)14-17(13,15-10(2,3)4)16-11(5,6)7/h9H,8H2,1-7H3.
What are the key properties of ditert-butyl 1-chloropropyl phosphate?
ditert-butyl 1-chloropropyl phosphate has a molecular weight of 286.74 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 1-chloropropyl phosphate is sourced from PubChem (CID 140959745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).