C20H38Cl4O8P2 — CID 98527111
[(E)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] [(2S)-2-chlorobutyl] [(2R)-2-chlorobutyl] phosphate (PubChem CID 98527111) has the molecular formula C20H38Cl4O8P2 and a molecular weight of 610.28 g/mol. Its IUPAC name is [(E)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] [(2S)-2-chlorobutyl] [(2R)-2-chlorobutyl] phosphate.
| Compound Name | [(E)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] [(2S)-2-chlorobutyl] [(2R)-2-chlorobutyl] phosphate |
|---|---|
| PubChem CID | 98527111 |
| Molecular Formula | C20H38Cl4O8P2 |
| Molecular Weight | 610.28 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | [(E)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] [(2S)-2-chlorobutyl] [(2R)-2-chlorobutyl] phosphate |
| SMILES | CC[C@@H](Cl)COP(=O)(OC[C@H](Cl)CC)O/C(C)=C(\C)OP(=O)(OC[C@H](Cl)CC)OC[C@@H](Cl)CC |
| InChI | InChI=1S/C20H38Cl4O8P2/c1-7-17(21)11-27-33(25,28-12-18(22)8-2)31-15(5)16(6)32-34(26,29-13-19(23)9-3)30-14-20(24)10-4/h17-20H,7-14H2,1-6H3/b16-15+/t17-,18-,19-,20+,34?/m1/s1 |
| InChIKey | LIYOQJAPSXULFY-NBCONFIWSA-N |
| XLogP | 8.62 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.28 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|