C20H40Cl4O6P2 — CID 98527087
(2S)-1-[[1-bis[(2R)-2-chlorobutoxy]phosphoryl-2-methylpropyl]-[(2R)-2-chlorobutoxy]phosphoryl]oxy-2-chlorobutane (PubChem CID 98527087) has the molecular formula C20H40Cl4O6P2 and a molecular weight of 580.29 g/mol. Its IUPAC name is (2S)-1-[[1-bis[(2R)-2-chlorobutoxy]phosphoryl-2-methylpropyl]-[(2R)-2-chlorobutoxy]phosphoryl]oxy-2-chlorobutane.
| Compound Name | (2S)-1-[[1-bis[(2R)-2-chlorobutoxy]phosphoryl-2-methylpropyl]-[(2R)-2-chlorobutoxy]phosphoryl]oxy-2-chlorobutane |
|---|---|
| PubChem CID | 98527087 |
| Molecular Formula | C20H40Cl4O6P2 |
| Molecular Weight | 580.29 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | (2S)-1-[[1-bis[(2R)-2-chlorobutoxy]phosphoryl-2-methylpropyl]-[(2R)-2-chlorobutoxy]phosphoryl]oxy-2-chlorobutane |
| SMILES | CC[C@@H](Cl)COP(=O)(OC[C@H](Cl)CC)C(C(C)C)P(=O)(OC[C@H](Cl)CC)OC[C@@H](Cl)CC |
| InChI | InChI=1S/C20H40Cl4O6P2/c1-7-16(21)11-27-31(25,28-12-17(22)8-2)20(15(5)6)32(26,29-13-18(23)9-3)30-14-19(24)10-4/h15-20H,7-14H2,1-6H3/t16-,17-,18-,19+,20?,32?/m1/s1 |
| InChIKey | IZHBVGQTGCJVOX-BFRUVIAXSA-N |
| XLogP | 8.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.29 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|