About [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate
[(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate (PubChem CID 98527117) has the molecular formula C20H38Cl4O8P2
and a molecular weight of 610.28 g/mol. Its IUPAC name is [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate.
Molecular Properties
| Compound Name | [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate |
|---|
| PubChem CID | 98527117 |
|---|
| Molecular Formula | C20H38Cl4O8P2 |
|---|
| Molecular Weight | 610.28 g/mol |
|---|
| Exact Mass | 608.08 |
|---|
| IUPAC Name | [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate |
|---|
| SMILES | CC[C@@H](Cl)COP(=O)(OC[C@H](Cl)CC)O/C(C)=C(/C)OP(=O)(OC[C@H](Cl)CC)OC[C@H](Cl)CC |
|---|
| InChI | InChI=1S/C20H38Cl4O8P2/c1-7-17(21)11-27-33(25,28-12-18(22)8-2)31-15(5)16(6)32-34(26,29-13-19(23)9-3)30-14-20(24)10-4/h17-20H,7-14H2,1-6H3/b16-15-/t17-,18-,19-,20-/m1/s1 |
|---|
| InChIKey | LIYOQJAPSXULFY-YJZAXOBZSA-N |
|---|
| XLogP | 8.62 |
|---|
| TPSA | 89.52 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 8 |
|---|
| Rotatable Bonds | 20 |
|---|
| Heavy Atoms | 34 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
2 violations
| Rule | Value |
|---|
| MW ≤ 500 | 610.28 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate?
The IUPAC name of [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate (CID 98527117) is [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate.
What is the SMILES notation for [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate?
The canonical SMILES for [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate is CC[C@@H](Cl)COP(=O)(OC[C@H](Cl)CC)O/C(C)=C(/C)OP(=O)(OC[C@H](Cl)CC)OC[C@H](Cl)CC.
What is the InChIKey of [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate?
The InChIKey is LIYOQJAPSXULFY-YJZAXOBZSA-N. The full InChI is InChI=1S/C20H38Cl4O8P2/c1-7-17(21)11-27-33(25,28-12-18(22)8-2)31-15(5)16(6)32-34(26,29-13-19(23)9-3)30-14-20(24)10-4/h17-20H,7-14H2,1-6H3/b16-15-/t17-,18-,19-,20-/m1/s1.
What are the key properties of [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate?
[(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate has a molecular weight of 610.28 g/mol, XLogP of 8.62, 20 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-bis[(2R)-2-chlorobutoxy]phosphoryloxybut-2-en-2-yl] bis[(2R)-2-chlorobutyl] phosphate is sourced from PubChem (CID 98527117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).