C48H45O10P — CID 172553590
tris[4-(2,4,6-trimethylbenzoyl)phenoxy] phosphate (PubChem CID 172553590) has the molecular formula C48H45O10P and a molecular weight of 812.85 g/mol. Its IUPAC name is tris[4-(2,4,6-trimethylbenzoyl)phenoxy] phosphate.
| Compound Name | tris[4-(2,4,6-trimethylbenzoyl)phenoxy] phosphate |
|---|---|
| PubChem CID | 172553590 |
| Molecular Formula | C48H45O10P |
| Molecular Weight | 812.85 g/mol |
| Exact Mass | 812.28 |
| IUPAC Name | tris[4-(2,4,6-trimethylbenzoyl)phenoxy] phosphate |
| SMILES | Cc1cc(C)c(C(=O)c2ccc(OOP(=O)(OOc3ccc(C(=O)c4c(C)cc(C)cc4C)cc3)OOc3ccc(C(=O)c4c(C)cc(C)cc4C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C48H45O10P/c1-28-22-31(4)43(32(5)23-28)46(49)37-10-16-40(17-11-37)53-56-59(52,57-54-41-18-12-38(13-19-41)47(50)44-33(6)24-29(2)25-34(44)7)58-55-42-20-14-39(15-21-42)48(51)45-35(8)26-30(3)27-36(45)9/h10-27H,1-9H3 |
| InChIKey | BSOJXMHOSMQVLP-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.85 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|