C22H26O4 — CID 139651443
2-(4-butoxyphenoxy)-3-(2,4,5-trimethylphenyl)prop-2-enoic acid (PubChem CID 139651443) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-(4-butoxyphenoxy)-3-(2,4,5-trimethylphenyl)prop-2-enoic acid.
| Compound Name | 2-(4-butoxyphenoxy)-3-(2,4,5-trimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 139651443 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-(4-butoxyphenoxy)-3-(2,4,5-trimethylphenyl)prop-2-enoic acid |
| SMILES | CCCCOc1ccc(OC(=Cc2cc(C)c(C)cc2C)C(=O)O)cc1 |
| InChI | InChI=1S/C22H26O4/c1-5-6-11-25-19-7-9-20(10-8-19)26-21(22(23)24)14-18-13-16(3)15(2)12-17(18)4/h7-10,12-14H,5-6,11H2,1-4H3,(H,23,24) |
| InChIKey | MXZSPKKARZIWNB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|