C18H14Cl2Ge — CID 139654373
dichloro-cyclopenta-2,4-dien-1-yl-(9H-fluoren-1-yl)germane (PubChem CID 139654373) has the molecular formula C18H14Cl2Ge and a molecular weight of 373.83 g/mol. Its IUPAC name is dichloro-cyclopenta-2,4-dien-1-yl-(9H-fluoren-1-yl)germane.
| Compound Name | dichloro-cyclopenta-2,4-dien-1-yl-(9H-fluoren-1-yl)germane |
|---|---|
| PubChem CID | 139654373 |
| Molecular Formula | C18H14Cl2Ge |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | dichloro-cyclopenta-2,4-dien-1-yl-(9H-fluoren-1-yl)germane |
| SMILES | Cl[Ge](Cl)(c1cccc2c1Cc1ccccc1-2)C1C=CC=C1 |
| InChI | InChI=1S/C18H14Cl2Ge/c19-21(20,14-7-2-3-8-14)18-11-5-10-16-15-9-4-1-6-13(15)12-17(16)18/h1-11,14H,12H2 |
| InChIKey | MRTCMXHPGHNBHW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |