C19H22ClF4N3O2 — CID 139660154
N-[(4-butan-2-yloxy-2,3,5,6-tetrafluorophenyl)methyl]-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)acetamide (PubChem CID 139660154) has the molecular formula C19H22ClF4N3O2 and a molecular weight of 435.85 g/mol. Its IUPAC name is N-[(4-butan-2-yloxy-2,3,5,6-tetrafluorophenyl)methyl]-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)acetamide.
| Compound Name | N-[(4-butan-2-yloxy-2,3,5,6-tetrafluorophenyl)methyl]-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 139660154 |
| Molecular Formula | C19H22ClF4N3O2 |
| Molecular Weight | 435.85 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[(4-butan-2-yloxy-2,3,5,6-tetrafluorophenyl)methyl]-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)acetamide |
| SMILES | CCc1nn(C)c(CC(=O)NCc2c(F)c(F)c(OC(C)CC)c(F)c2F)c1Cl |
| InChI | InChI=1S/C19H22ClF4N3O2/c1-5-9(3)29-19-17(23)15(21)10(16(22)18(19)24)8-25-13(28)7-12-14(20)11(6-2)26-27(12)4/h9H,5-8H2,1-4H3,(H,25,28) |
| InChIKey | UBQSFHQASHDQLM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.85 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|