C20H16ClF12N3O2 — CID 139660178
2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-[[2,3,5,6-tetrafluoro-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]methyl]acetamide (PubChem CID 139660178) has the molecular formula C20H16ClF12N3O2 and a molecular weight of 593.80 g/mol. Its IUPAC name is 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-[[2,3,5,6-tetrafluoro-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-[[2,3,5,6-tetrafluoro-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 139660178 |
| Molecular Formula | C20H16ClF12N3O2 |
| Molecular Weight | 593.80 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-[[2,3,5,6-tetrafluoro-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]methyl]acetamide |
| SMILES | CCc1nn(C)c(CC(=O)NCc2c(F)c(F)c(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)c(F)c2F)c1Cl |
| InChI | InChI=1S/C20H16ClF12N3O2/c1-3-8-11(21)9(36(2)35-8)4-10(37)34-5-7-12(22)14(24)16(15(25)13(7)23)38-6-18(28,29)20(32,33)19(30,31)17(26)27/h17H,3-6H2,1-2H3,(H,34,37) |
| InChIKey | JSPOHQSXEPNSCK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|