C26H26N4O6 — CID 139660576
(2S)-2-[(1,3-dioxoisoindol-2-yl)methyl-(2-hydroxyimino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 139660576) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is (2S)-2-[(1,3-dioxoisoindol-2-yl)methyl-(2-hydroxyimino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[(1,3-dioxoisoindol-2-yl)methyl-(2-hydroxyimino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 139660576 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (2S)-2-[(1,3-dioxoisoindol-2-yl)methyl-(2-hydroxyimino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)CC(=NO)C(=O)N(CN1C(=O)c2ccccc2C1=O)[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H26N4O6/c1-15(2)11-21(28-36)25(33)29(14-30-23(31)18-8-3-4-9-19(18)24(30)32)22(26(34)35)12-16-13-27-20-10-6-5-7-17(16)20/h3-10,13,15,22,27,36H,11-12,14H2,1-2H3,(H,34,35)/t22-/m0/s1 |
| InChIKey | IONPULOQHCHSCN-QFIPXVFZSA-N |
| XLogP | 3.12 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|