C20H24N4O4 — CID 139761853
(2S)-2-[2-cyanoethyl-(2-hydroxyimino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 139761853) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is (2S)-2-[2-cyanoethyl-(2-hydroxyimino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[2-cyanoethyl-(2-hydroxyimino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 139761853 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2S)-2-[2-cyanoethyl-(2-hydroxyimino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)CC(=NO)C(=O)N(CCC#N)[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H24N4O4/c1-13(2)10-17(23-28)19(25)24(9-5-8-21)18(20(26)27)11-14-12-22-16-7-4-3-6-15(14)16/h3-4,6-7,12-13,18,22,28H,5,9-11H2,1-2H3,(H,26,27)/t18-/m0/s1 |
| InChIKey | AVVVMKJFNZUPPX-SFHVURJKSA-N |
| XLogP | 2.78 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|