C16H29N3O5 — CID 139664112
[1-hydroxy-1-[3-[1-(1-hydroxybutylamino)ethyl]-2-oxoimidazolidin-1-yl]propyl] 2-methylprop-2-enoate (PubChem CID 139664112) has the molecular formula C16H29N3O5 and a molecular weight of 343.42 g/mol. Its IUPAC name is [1-hydroxy-1-[3-[1-(1-hydroxybutylamino)ethyl]-2-oxoimidazolidin-1-yl]propyl] 2-methylprop-2-enoate.
| Compound Name | [1-hydroxy-1-[3-[1-(1-hydroxybutylamino)ethyl]-2-oxoimidazolidin-1-yl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139664112 |
| Molecular Formula | C16H29N3O5 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [1-hydroxy-1-[3-[1-(1-hydroxybutylamino)ethyl]-2-oxoimidazolidin-1-yl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(O)(CC)N1CCN(C(C)NC(O)CCC)C1=O |
| InChI | InChI=1S/C16H29N3O5/c1-6-8-13(20)17-12(5)18-9-10-19(15(18)22)16(23,7-2)24-14(21)11(3)4/h12-13,17,20,23H,3,6-10H2,1-2,4-5H3 |
| InChIKey | KPMCEWHXFYXHDN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|