C12H9Cl3N2O3 — CID 139664215
[2-(2-amino-2-oxoethyl)-1H-indol-3-yl] 2,2,2-trichloroacetate (PubChem CID 139664215) has the molecular formula C12H9Cl3N2O3 and a molecular weight of 335.57 g/mol. Its IUPAC name is [2-(2-amino-2-oxoethyl)-1H-indol-3-yl] 2,2,2-trichloroacetate.
| Compound Name | [2-(2-amino-2-oxoethyl)-1H-indol-3-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 139664215 |
| Molecular Formula | C12H9Cl3N2O3 |
| Molecular Weight | 335.57 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | [2-(2-amino-2-oxoethyl)-1H-indol-3-yl] 2,2,2-trichloroacetate |
| SMILES | NC(=O)Cc1[nH]c2ccccc2c1OC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H9Cl3N2O3/c13-12(14,15)11(19)20-10-6-3-1-2-4-7(6)17-8(10)5-9(16)18/h1-4,17H,5H2,(H2,16,18) |
| InChIKey | VSAKVFBZWCKSOD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|