C45H48F6O7 — CID 139665011
[(6S,8S)-7-oxo-8-(4-phenylmethoxybenzoyl)oxy-6,8-bis(2,2,2-trifluoroethyl)tridecan-6-yl] 4-phenylmethoxybenzoate (PubChem CID 139665011) has the molecular formula C45H48F6O7 and a molecular weight of 814.86 g/mol. Its IUPAC name is [(6S,8S)-7-oxo-8-(4-phenylmethoxybenzoyl)oxy-6,8-bis(2,2,2-trifluoroethyl)tridecan-6-yl] 4-phenylmethoxybenzoate.
| Compound Name | [(6S,8S)-7-oxo-8-(4-phenylmethoxybenzoyl)oxy-6,8-bis(2,2,2-trifluoroethyl)tridecan-6-yl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 139665011 |
| Molecular Formula | C45H48F6O7 |
| Molecular Weight | 814.86 g/mol |
| Exact Mass | 814.33 |
| IUPAC Name | [(6S,8S)-7-oxo-8-(4-phenylmethoxybenzoyl)oxy-6,8-bis(2,2,2-trifluoroethyl)tridecan-6-yl] 4-phenylmethoxybenzoate |
| SMILES | CCCCC[C@@](CC(F)(F)F)(OC(=O)c1ccc(OCc2ccccc2)cc1)C(=O)[C@](CCCCC)(CC(F)(F)F)OC(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C45H48F6O7/c1-3-5-13-27-42(31-44(46,47)48,57-39(52)35-19-23-37(24-20-35)55-29-33-15-9-7-10-16-33)41(54)43(28-14-6-4-2,32-45(49,50)51)58-40(53)36-21-25-38(26-22-36)56-30-34-17-11-8-12-18-34/h7-12,15-26H,3-6,13-14,27-32H2,1-2H3/t42-,43-/m0/s1 |
| InChIKey | FBFARTPGMGHMEX-MJPWBCPGSA-N |
| XLogP | 11.97 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.86 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|