About 2-butyl-3-fluorooxirene
2-butyl-3-fluorooxirene (PubChem CID 139665601) has the molecular formula C6H9FO
and a molecular weight of 116.13 g/mol. Its IUPAC name is 2-butyl-3-fluorooxirene.
Molecular Properties
| Compound Name | 2-butyl-3-fluorooxirene |
| PubChem CID | 139665601 |
| Molecular Formula | C6H9FO |
| Molecular Weight | 116.13 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 2-butyl-3-fluorooxirene |
| SMILES | CCCCC1=C(F)O1 |
| InChI | InChI=1S/C6H9FO/c1-2-3-4-5-6(7)8-5/h2-4H2,1H3 |
| InChIKey | PAQHPTCXDATZSB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-3-fluorooxirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-fluorooxirene?
The IUPAC name of 2-butyl-3-fluorooxirene (CID 139665601) is 2-butyl-3-fluorooxirene.
What is the SMILES notation for 2-butyl-3-fluorooxirene?
The canonical SMILES for 2-butyl-3-fluorooxirene is CCCCC1=C(F)O1.
What is the InChIKey of 2-butyl-3-fluorooxirene?
The InChIKey is PAQHPTCXDATZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FO/c1-2-3-4-5-6(7)8-5/h2-4H2,1H3.
What are the key properties of 2-butyl-3-fluorooxirene?
2-butyl-3-fluorooxirene has a molecular weight of 116.13 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-fluorooxirene is sourced from PubChem (CID 139665601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).