C21H23Cl2N3O3S — CID 139669982
tert-butyl N-[2-[4-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]ethyl]carbamate (PubChem CID 139669982) has the molecular formula C21H23Cl2N3O3S and a molecular weight of 468.41 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 139669982 |
| Molecular Formula | C21H23Cl2N3O3S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | tert-butyl N-[2-[4-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(NC(=S)NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H23Cl2N3O3S/c1-21(2,3)29-20(28)24-11-10-13-4-7-15(8-5-13)25-19(30)26-18(27)16-9-6-14(22)12-17(16)23/h4-9,12H,10-11H2,1-3H3,(H,24,28)(H2,25,26,27,30) |
| InChIKey | BEHIKNHULDNUSZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|