C6H6N4O2 — CID 139670351
N,N'-dicyano-N'-ethyloxamide (PubChem CID 139670351) has the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. Its IUPAC name is N,N'-dicyano-N'-ethyloxamide.
| Compound Name | N,N'-dicyano-N'-ethyloxamide |
|---|---|
| PubChem CID | 139670351 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | N,N'-dicyano-N'-ethyloxamide |
| SMILES | CCN(C#N)C(=O)C(=O)NC#N |
| InChI | InChI=1S/C6H6N4O2/c1-2-10(4-8)6(12)5(11)9-3-7/h2H2,1H3,(H,9,11) |
| InChIKey | IFTXTMDPFWSPIQ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|