C23H15ClF3N3O2 — CID 139674011
4-chloro-1-(2,5-difluorophenyl)-5-(4-fluorophenyl)-N-phenylmethoxypyrazole-3-carboxamide (PubChem CID 139674011) has the molecular formula C23H15ClF3N3O2 and a molecular weight of 457.84 g/mol. Its IUPAC name is 4-chloro-1-(2,5-difluorophenyl)-5-(4-fluorophenyl)-N-phenylmethoxypyrazole-3-carboxamide.
| Compound Name | 4-chloro-1-(2,5-difluorophenyl)-5-(4-fluorophenyl)-N-phenylmethoxypyrazole-3-carboxamide |
|---|---|
| PubChem CID | 139674011 |
| Molecular Formula | C23H15ClF3N3O2 |
| Molecular Weight | 457.84 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 4-chloro-1-(2,5-difluorophenyl)-5-(4-fluorophenyl)-N-phenylmethoxypyrazole-3-carboxamide |
| SMILES | O=C(NOCc1ccccc1)c1nn(-c2cc(F)ccc2F)c(-c2ccc(F)cc2)c1Cl |
| InChI | InChI=1S/C23H15ClF3N3O2/c24-20-21(23(31)29-32-13-14-4-2-1-3-5-14)28-30(19-12-17(26)10-11-18(19)27)22(20)15-6-8-16(25)9-7-15/h1-12H,13H2,(H,29,31) |
| InChIKey | XXYRCIZVBGUJSA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.84 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|